N<sup>1</sup>,N<sup>5</sup>-Bis-Boc-spermidine , 97% , 68076-39-1
Synonym(s):
{4-[(3-Aminopropyl)-tert-butoxycarbonylamino]butyl}carbamic acid tert-butyl ester;N1,N5-Di-Boc-1,8-diamino-5-azaoctane;1,6-Bis-Boc-1,6,10-triazadecane
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB2655.20 | In Stock |
|
| 250MG | RMB5642.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 462.0±38.0 °C(Predicted) |
| Density | 1.028±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | liquid |
| pka | 12.87±0.46(Predicted) |
| Appearance | Colorless to off-white Viscous Liquid |
| BRN | 2059741 |
| InChI | 1S/C17H35N3O4/c1-16(2,3)23-14(21)19-11-7-8-12-20(13-9-10-18)15(22)24-17(4,5)6/h7-13,18H2,1-6H3,(H,19,21) |
| InChIKey | AGIUPQUTLBAVDK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCN(CCCN)C(=O)OC(C)(C)C |
Description and Uses
N1,N5-Bis-Boc-spermidine is a linker containing an amino group with two Boc-protected amino groups. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine.
N1,N5-Bis-Boc-spermidine is a linker containing an amino group with two Boc-protected amino groups. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| HS Code | 29225090 |
| Storage Class | 13 - Non Combustible Solids |






