LN8382646
DehydronitrosoNifedipine , Medicinal reagent , 50428-14-3
Synonym(s):
Dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)-3,5-pyridinedicarboxylate
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB13761.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93℃ |
| Boiling point: | 449.0±45.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 1.86±0.29(Predicted) |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | 1S/C17H16N2O5/c1-9-13(16(20)23-3)15(11-7-5-6-8-12(11)19-22)14(10(2)18-9)17(21)24-4/h5-8H,1-4H3 |
| InChIKey | MUZLTKGYFZENFW-UHFFFAOYSA-N |
| SMILES | O=C(OC)C1=C(C2=C(N=O)C=CC=C2)C(C(OC)=O)=C(C)N=C1C |
Description and Uses
A photodegradation product of Nifedipine (N457000). Shown to relax contractions of the rat aortic strip induced by norepinephrine and other agonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
