LN8995846
Picrotoxinin , Analysis standard , 17617-45-7
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2093.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-205°C |
| alpha | D17 +4.4° (c = 4.28 in abs alc), +3.49° (c = 7.57 in acetone) |
| Boiling point: | 354.22°C (rough estimate) |
| Density | 1.2207 (rough estimate) |
| refractive index | 1.4359 (estimate) |
| storage temp. | 2-8°C |
| pka | 13.18±0.60(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C15H16O6/c1-5(2)7-8-11(16)19-9(7)10-13(3)14(8,18)4-6-15(13,21-6)12(17)20-10/h6-10,18H,1,4H2,2-3H3/t6-,7+,8+,9-,10-,13-,14-,15+/m1/s1 |
| InChIKey | PIMZUZSSNYHVCU-KBLUICEQSA-N |
| SMILES | [H][C@@]12OC(=O)[C@]([H])([C@@H]1C(C)=C)[C@]3(O)C[C@H]4O[C@]45C(=O)O[C@@]2([H])[C@]35C |
| LogP | -0.130 (est) |
| EPA Substance Registry System | Picrotoxinin (17617-45-7) |
Description and Uses
Picrotoxinin is a L-glutamate and channel blockers.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P301+P310+P330 |
| Hazard Codes | T+ |
| Risk Statements | 25-28 |
| Safety Statements | 13-20-45-36/37-28 |
| RIDADR | 3172 |
| WGK Germany | 3 |
| RTECS | PC5150000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
| Toxicity | LD50 i.p. in mice: 3 mg/kg (Jarboe) |







