LN901888
2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactopyranose , ≥95% , 420118-03-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1966.40 | In Stock |
|
| 250mg | RMB2908.00 | In Stock |
|
| 500mg | RMB4138.40 | In Stock |
|
| 1g | RMB5908.80 | In Stock |
|
| 2g | RMB8984.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-215°C |
| Boiling point: | 601.2±55.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in DMSO |
| form | Solid |
| pka | 13.01±0.20(Predicted) |
| color | White |
| InChI | 1S/C15H19NO6/c1-8(17)16-11-12(18)13-10(21-14(11)19)7-20-15(22-13)9-5-3-2-4-6-9/h2-6,10-15,18-19H,7H2,1H3,(H,16,17)/t10-,11-,12-,13+,14,15/m1/s1 |
| InChIKey | OIXDAEIOQFFRMF-YNBGEIFUSA-N |
| SMILES | O=C(C)N[C@@H](C(O)O1)[C@@H](O)[C@@]([C@@]1([H])CO2)([H])OC2C3=CC=CC=C3 |
Description and Uses
2-(Acetylamino)-2-deoxy-4,6-O-(phenylmethylene)-D-galactose is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |






