LN9040358
Ethanone,1-(3,4-dihydro-2H-pyrrol-5-yl)- , 85213-22-5
| Pack Size | Price | Stock | Quantity |
| 1kg | RMB4448.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 182.9±23.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 5.69±0.20(Predicted) |
| Odor | characteristic odor of white bread crust |
| Odor Type | popcorn |
| InChI | InChI=1S/C6H9NO/c1-5(8)6-3-2-4-7-6/h2-4H2,1H3 |
| InChIKey | DQBQWWSFRPLIAX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=NCCC1)C |
| LogP | -0.019 (est) |
Description and Uses
It is isolated from rice and identified as the compound responsible for the flavor and aroma of scented rice after cooking.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
