LN9139346
2，4，6-Trichloro , Analysis standard reagent , 352439-08-8
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB3676.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-62 °C(lit.) |
| Boiling point: | 132 °C/28 mmHg(lit.) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) |
| form | Solid |
| color | White to off-white |
| Major Application | agriculture cleaning products cosmetics environmental flavors and fragrances food and beverages personal care |
| InChI | 1S/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3/i1D3,2D,3D |
| InChIKey | WCVOGSZTONGSQY-RHIBPKLGSA-N |
| SMILES | [2H]c1c(Cl)c([2H])c(Cl)c(OC([2H])([2H])[2H])c1Cl |
Description and Uses
Labelled 2,4,6-Trichloro
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H413 |
| Precautionary statements | P273-P301+P312+P330-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |
