LN961888
8-Aminoadenosine , ≥95% , 3868-33-5
Synonym(s):
6,8-Diamino-9-β-D-ribofuranosyl-9H-purine;8-Amino Adenosine;8-Amino-Adenosine;8-NH2-Ado;NSC 90394
| Pack Size | Price | Stock | Quantity |
| 1g | RMB15527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-185°C dec. |
| Boiling point: | 747.1±70.0 °C(Predicted) |
| Density | 2.25 |
| storage temp. | -20°C Freezer |
| solubility | H2O: soluble2mg/mL, clear (warmed) |
| pka | 13.07±0.70(Predicted) |
| form | powder |
| color | white to beige |
| Water Solubility | H2O: 2mg/mL, clear (warmed) |
| InChI | 1S/C10H14N6O4/c11-7-4-8(14-2-13-7)16(10(12)15-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,15)(H2,11,13,14) |
| InChIKey | DVGWFQILDUEEGX-UHFFFAOYSA-N |
| SMILES | [n]2(c3ncnc(c3nc2N)N)C1OC(C(C1O)O)CO |
Description and Uses
The purine nucleoside analog
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
