LN9632053
98% , 27885-92-3
CAS NO.:27885-92-3
Empirical Formula: C19H20N6O
Molecular Weight: 348.4
MDL number: MFCD00693581
EINECS: 248-711-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB904.00 | In Stock |
|
| 5g | RMB3594.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >235°C (dec.) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 13.81±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26) |
| InChIKey | SCEVFJUWLLRELN-UHFFFAOYSA-N |
| SMILES | N(C1=CC=CC(C2NCCN=2)=C1)C(NC1=CC=CC(C2NCCN=2)=C1)=O |
| CAS DataBase Reference | 27885-92-3(CAS DataBase Reference) |
Description and Uses
Imidocarb is a urea derived antiprotozoal agent used in veterinary medicine for the treatment of infection with babesia and other parasites.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H361-H370 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |






