M0009835
trans-2-Butenaldiethylacetal , 96% , 63511-92-2
| Pack Size | Price | Stock | Quantity |
| 5mL | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 146-150 °C(lit.) |
| Density | 0.831 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 93 °F |
| InChI | 1S/C8H16O2/c1-4-7-8(9-5-2)10-6-3/h4,7-8H,5-6H2,1-3H3/b7-4+ |
| InChIKey | ZUMISMXLQDKQDS-QPJJXVBHSA-N |
| SMILES | [H]\C(C)=C(\[H])C(OCC)OCC |
| LogP | 2.280 (est) |
Description and Uses
trans-2-Butenal diethyl acetal may be used in the preparation of 2S,3S-epoxybutan-1-ol, an intermediate in the synthesis of erythromycin antibiotic.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |








