M0041635
Bisantrene , >96% , 78186-34-2
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1571.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 646.3±65.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | deionized water: soluble8mg/mL |
| pka | 9.78±0.10(Predicted) |
| form | solid |
| color | Orange to red |
| Water Solubility | deionized water: 8mg/mL |
| InChIKey | NJSMWLQOCQIOPE-OCHFTUDZSA-N |
| SMILES | C1(/C=N/NC2=NCCN2)=C2C=CC=CC2=C(/C=N/NC2=NCCN2)C2C=CC=CC1=2 |
Description and Uses
Antineoplastic.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H400 |
| Precautionary statements | P273-P301+P312+P330 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |





![(S)-6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole](https://img.chemicalbook.com/CAS/GIF/14769-73-4.gif)

