M0150650
Clonidine , 98% , 4205-90-7
Synonym(s):
2-(2,6-Dichloroanilino)-2-imidazoline
CAS NO.：4205-90-7
Empirical Formula: C9H9Cl2N3
Molecular Weight: 230.09
MDL number: MFCD00055059
EINECS: 224-119-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB520.00 | In Stock |
|
| 250mg | RMB880.00 | In Stock |
|
| 1g | RMB1744.00 | In Stock |
|
| 5g | RMB6080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-142℃ |
| Boiling point: | 369.21°C (rough estimate) |
| Density | 1.3946 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | DMSO:100.0(Max Conc. mg/mL);434.61(Max Conc. mM) |
| pka | 8.10±0.50(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14) |
| InChIKey | GJSURZIOUXUGAL-UHFFFAOYSA-N |
| SMILES | Clc1c(c(ccc1)Cl)NC2=NCCN2 |
| CAS DataBase Reference | 4205-90-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazol-2-amine, N-(2,6-dichlorophenyl)-4,5-dihydro- (4205-90-7) |
Description and Uses
Antihypertensive.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| HS Code | 2933290000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Hazardous Substances Data | 4205-90-7(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 67300ug/kg |
