M0174735
2,4-Bis(p-tolylthio)-1,3-dithia-2,4-diphosphetane2,4-Disulfide , GR , 114234-09-2
Synonym(s):
CAPB;ERK;PCBC;DRT;DR-T
| Pack Size | Price | Stock | Quantity |
| 1g | RMB574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-213 °C (dec.) |
| Boiling point: | 566.2±53.0 °C(Predicted) |
| Density | 1.52±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly, Heated), DMSO (Sparingly, Heated) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| biological source | mouse |
| BRN | 7222715 |
| InChI | 1S/C14H14P2S6/c1-11-3-7-13(8-4-11)19-15(17)21-16(18,22-15)20-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | WMYQGZHFMUDZIS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SP2(=S)SP(=S)(Sc3ccc(C)cc3)S2)cc1 |
Description and Uses
2,4-Bis(p-tolylthio)-1,3-dithia-2,4-diphosphetane-2,4-disulfide is used in preparation of (Cyclohexyl)pyridine Carboxamides as herbicides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| F | 13 |
| HS Code | 2931.90.6000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |




