M0193835
Benzoyl-d5Chloride , 99atom%D , 43019-90-5
Synonym(s):
Pentadeuterobenzoyl chloride
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB555.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -1 °C (lit.) |
| Boiling point: | 198 °C (lit.) |
| Density | 1.254 g/mL at 25 °C |
| refractive index | n 20/D 1.552 (lit.) |
| Flash point: | 72 °C - closed cup |
| solubility | soluble in Chloroform |
| form | liquid |
| color | Colourless |
| BRN | 1955377 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | PASDCCFISLVPSO-RALIUCGRSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(Cl)=O |
| CAS Number Unlabeled | 98-88-4 |
Description and Uses
(Benzoyl-d5 Chloride) Labelled Benzoyl Chloride. Used in the manufacturing of dye intermediates.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302+H312-H314-H317-H331 |
| Precautionary statements | P261-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-43-20/21/22 |
| Safety Statements | 26-45-36/37/39 |
| RIDADR | UN 1736 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| HS Code | 29163200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
