PRODUCT Properties
| Melting point: | 187-188℃ |
| Boiling point: | 544.3±50.0 °C(Predicted) |
| Density | 1.386±0.06 g/cm3 (20 ºC 760 Torr) |
| solubility | Soluble in acetone, chloroform and methan |
| form | powder |
| pka | 13.80±0.20(Predicted) |
| color | White |
| InChI | InChI=1S/C16H16O6/c1-16(2,19)13(17)8-21-15-9-3-4-14(18)22-12(9)7-11-10(15)5-6-20-11/h3-7,13,17,19H,8H2,1-2H3/t13-/m1/s1 |
| InChIKey | PEWFWDOPJISUOK-CYBMUJFWSA-N |
| SMILES | C1(=O)OC2=CC3OC=CC=3C(OC[C@@H](O)C(O)(C)C)=C2C=C1 |
| LogP | 1.575 (est) |
Description and Uses
Oxypeucedanin hydrate ((+)-Oxypeucedanin hydrate) is a natural product isolated from D. anethifolia. Prangol exhibits mild toxicity on fibroblasts and parental lymphoma cells[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P272-P280-P301+P312-P330-P302+P352-P333+P313-P321-P363-P501 |
