PRODUCT Properties
| Melting point: | >222oC(dec.) |
| Density | 1.75±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -86°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | 3.47±0.10(Predicted) |
| form | Solid |
| color | Pale Beige to Yellow |
| Stability: | Hygroscopic, Moisture Sensitive, Temperature Sensitive |
| InChIKey | QYNUQALWYRSVHF-ABLWVSNPSA-N |
| SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)C1=CC=C(N2CC3CNC4=C(N3C2)C(=O)NC(N)=N4)C=C1 |
Description and Uses
5,10-methylenetetrahydrofolate is a stable folate lyophilized compound suitable for use in the treatment of cancer and other therapies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |





![N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic acid](https://img.chemicalbook.com/CAS/GIF/134-05-4.gif)

![(2S)-2-[[4-[Bis[(2-aMino-4-oxo-1,4-dihydropteridin-6-yl)Methyl]aMino]benzoyl]aMino]pentanedioic Acid](https://img.chemicalbook.com/CAS/20130318/GIF/1391068-26-0.gif)