LN5269957
2-Amino-7-(chloromethyl)pteridin-4(3H)-one , 1391194-56-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB4727.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >292°C (dec.) |
| Boiling point: | 370.0±44.0 °C(Predicted) |
| Density | 1.91±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 1.79±0.20(Predicted) |
| color | Dark Yellow |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C7H6ClN5O/c8-1-3-2-10-4-5(11-3)12-7(9)13-6(4)14/h2H,1H2,(H3,9,11,12,13,14) |
| InChIKey | WHPPYWZHBUBHST-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC=C(CCl)N=2)C(=O)NC=1N |
Description and Uses
2-Amino-7-(chloromethyl)pteridin-4(1H)-one is the impurity F of Folic acid (F680300) as per EP monograph.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |



![N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic acid](https://img.chemicalbook.com/CAS/GIF/134-05-4.gif)

![(2S)-2-[[4-[Bis[(2-aMino-4-oxo-1,4-dihydropteridin-6-yl)Methyl]aMino]benzoyl]aMino]pentanedioic Acid](https://img.chemicalbook.com/CAS/20130318/GIF/1391068-26-0.gif)