M0855635
Choline-1,1,2,2-d4bromide , 98atom%D , 285979-69-3
CAS NO.：285979-69-3
Empirical Formula: C5H14BrNO
Molecular Weight: 184.08
MDL number: MFCD01075444
EINECS: 693-581-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1348.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289 - 290°C |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | DMF (Slightly, Heated), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C5H14NO.BrH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1/i4D2,5D2; |
| InChIKey | JJCWKVUUIFLXNZ-HGFPCDIYSA-M |
| SMILES | [Br-].[2H]C([2H])(O)C([2H])([2H])[N+](C)(C)C |
Description and Uses
Choline-1,1,2,2-d4 Bromide (CAS# 285979-69-3) is a useful isotopically labeled research compound.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
