M0895935
Cirsiliol , 98% , 34334-69-5
Synonym(s):
5,3′,4′-Trihydroxy-6,7-dimethoxyflavone;6,7-Dimethoxy-5,3′,4′-trihydroxyflavone;6-Hydroxyluteolin-6,7-dimethyl ether;6-Methoxyluteolin 7-methyl ether;Crisiliol
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2083.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280-281.5℃ (methanol ) |
| Boiling point: | 616.1±55.0 °C(Predicted) |
| Density | 1.483±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetone: soluble; Chloroform: soluble; DMSO: soluble |
| form | powder |
| pka | 6.31±0.40(Predicted) |
| color | white to beige |
| InChI | 1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3 |
| InChIKey | IMEYGBIXGJLUIS-UHFFFAOYSA-N |
| SMILES | [o]1c2c([c](cc1c3cc(c(cc3)O)O)=O)c(c(c(c2)OC)OC)O |
Description and Uses
Cirsiliol is a potent and selective 5-lipoxygenase inhibitor and a competitive low affinity benzodiazepine receptor ligand.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| RTECS | DJ3011100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
