M1029735
2,6-Dichloroquinone-4-chloroimide , CP,95% , 101-38-2
CAS NO.:101-38-2
Empirical Formula: C6H2Cl3NO
Molecular Weight: 210.45
MDL number: MFCD00001611
EINECS: 202-937-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB292.80 | In Stock |
|
| 25g | RMB1216.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-67 °C(lit.) |
| Boiling point: | 262.3±50.0 °C(Predicted) |
| Density | 1.5917 (rough estimate) |
| bulk density | 800kg/m3 |
| refractive index | 1.5470 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly) |
| form | crystalline |
| pka | -4?+-.0.20(Predicted) |
| color | yellow |
| Water Solubility | Insoluble |
| Merck | 14,4421 |
| Stability: | Stable. Keep refrigerated. |
| InChI | 1S/C6H2Cl3NO/c7-4-1-3(10-9)2-5(8)6(4)11/h1-2H |
| InChIKey | YHUMTHWQGWPJOQ-UHFFFAOYSA-N |
| SMILES | Cl\N=C1\C=C(Cl)C(=O)C(Cl)=C1 |
| CAS DataBase Reference | 101-38-2(CAS DataBase Reference) |
| NIST Chemistry Reference | N,2,6-trichloro-p-quinoneimine(101-38-2) |
| EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 2,6-dichloro-4-(chloroimino)- (101-38-2) |
Description and Uses
In determination of phenols.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H242-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi,Xn,E |
| Risk Statements | 5-11-36/37/38-20/22-2 |
| Safety Statements | 15-26-36/37/39-33-16-36 |
| RIDADR | UN 3224 4.1 |
| WGK Germany | 3 |
| RTECS | GU5470000 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29251900 |
| Storage Class | 4.1A - Other explosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Self-react. C Skin Irrit. 2 |






