M1514941
Pilocarpine , AR , 92-13-7
Synonym(s):
cis-3-Ethyl-4-(1-methyl-5-imidazolylmethyl)dihydro-2(3H)-furanone
CAS NO.:92-13-7
Empirical Formula: C11H16N2O2
Molecular Weight: 208.26
MDL number: MFCD00153042
EINECS: 202-128-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB3510.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34° |
| alpha | D18 +106° (c = 2) |
| Boiling point: | bp5 260° (partial conversion to isopilocarpine) |
| Density | 1.1123 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| solubility | Chloroform (Sparingly, Sonicated), Methanol (Slightly) |
| pka | 6.87(at 30℃) |
| form | <34°C Solid,>34°C Liquid |
| color | Colorless to light yellow |
| optical activity | +10618 (H2O) |
| InChI | InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | QCHFTSOMWOSFHM-WPRPVWTQSA-N |
| SMILES | O1C[C@H](CC2N(C)C=NC=2)[C@H](CC)C1=O |
| LogP | 0.120 |
| CAS DataBase Reference | 92-13-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2(3H)-Furanone, 3-ethyldihydro-4-[(1-methyl-1H-imidazol-5-yl)methyl]-, (3S,4R)- (92-13-7) |
Description and Uses
Pilocarpine acts by stimulating muscarinic receptors, therefore making it similar in action to acetylcholine when systematically introduced. This compound differs from acetylcholine in that it does not react with any nicotinic receptors, but by stimulating the CNS. Its effects are blocked by atropine. It has found therapeutic use in ophthalmology as a myotic agent.
Cholinergic (ophthalmic).
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330 |
| Precautionary statements | P260-P264-P284-P301+P310-P310 |
| Hazard Codes | T+ |
| Risk Statements | 26/28 |
| Safety Statements | 25-45 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2939800000 |
| Hazardous Substances Data | 92-13-7(Hazardous Substances Data) |





