M5057135
Pilocarpinenitrate? , 98% , 148-72-1
Synonym(s):
Pilocarpine nitrate salt
CAS NO.:148-72-1
Empirical Formula: C11H17N3O5
Molecular Weight: 271.27
MDL number: MFCD00078497
EINECS: 205-723-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB742.40 | In Stock |
|
| 500mg | RMB2592.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173,5-174°C |
| alpha | D +77 to +83° (c = 10) |
| refractive index | 81 ° (C=2, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, very faintly yellow |
| form | powder |
| color | white |
| optical activity | [α]25/D +83°, c = 10 in H2O(lit.) |
| Water Solubility | H2O: 100mg/mL |
| Merck | 14,7424 |
| BRN | 4171406 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C11H16N2O2.HNO3/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2;2-1(3)4/h5,7-8,10H,3-4,6H2,1-2H3;(H,2,3,4)/t8-,10-;/m0./s1 |
| InChIKey | PRZXEPJJHQYOGF-GNAZCLTHSA-N |
| SMILES | O[N+]([O-])=O.CC[C@H]1[C@H](COC1=O)Cc2cncn2C |
| CAS DataBase Reference | 148-72-1(CAS DataBase Reference) |
| EPA Substance Registry System | Pilocarpine nitrate (148-72-1) |
Description and Uses
Pilocarpine nitrate salt has been used to measure bronchoconstriction and M2 and M3 muscarinic receptor function in vivo. It has also been used to induce electrographic and behavioral seizures and to study the different patterns of neuronal activation and neurodegeneration in Proechimys rats and Wistar rats.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS06 |
| Signal word | Danger |
| Hazard statements | H272-H302-H330 |
| Precautionary statements | P210-P220-P260-P264-P301+P312-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,T+ |
| Risk Statements | 22-26/28 |
| Safety Statements | 1-25-45 |
| RIDADR | 3087 |
| WGK Germany | 3 |
| RTECS | TK1455000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2939800000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Ox. Sol. 2 |
| Toxicity | LD50 oral in rat: 911mg/kg |






