PRODUCT Properties
| Boiling point: | 238.5℃ |
| Density | 1.841±0.06 g/cm3 (20 ºC 760 Torr) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -3.34±0.50(Predicted) |
| form | Solid |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6HF13O3S/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h(H,20,21,22) |
| InChIKey | QZHDEAJFRJCDMF-UHFFFAOYSA-N |
| SMILES | C(F)(F)(S(O)(=O)=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| EPA Substance Registry System | Perfluorohexanesulfonic acid (355-46-4) |
Description and Uses
Perfluorohexane sulfonate is a six-carbon compound in the perfluoroalkyl family of chemicals. Perfluorohexane sulfonate was once used in firefighting foam and carpet treatment solutions. It was once widely used by 3M as a stain and water repellent but was phased out due to U.S. Environmental Protection Agency regulations. Much like other perfluoroalkyls, PFHxS can persist in the environment.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H335 |
| Precautionary statements | P260-P261-P264-P270-P271-P280-P301+P310+P330+P331-P303+P361+P353+P310-P304+P340+P310-P305+P351+P338+P310-P363-P403+P233-P405-P501 |
| HS Code | 2904990090 |
| Hazardous Substances Data | 355-46-4(Hazardous Substances Data) |
