M1520941
Tetrabutylammonium(meta)periodate , 97% , 65201-77-6
CAS NO.:65201-77-6
Empirical Formula: C16H36INO4
Molecular Weight: 433.37
MDL number: MFCD00011852
EINECS: 265-614-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB196.80 | In Stock |
|
| 25g | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175 °C (dec.) (lit.) |
| Density | 1.2302 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | solid |
| Appearance | white crystalline solid |
| BRN | 4621593 |
| InChI | 1S/C16H36N.HIO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | PYVXLMQALOZKES-UHFFFAOYSA-M |
| SMILES | [O-]I(=O)(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
Description and Uses
Tetrabutylammonium periodate is useful reagent in oxidation of sulfides, phenacyl bromides, benzyl halides, phosphites; oxidative decarboxylation; co-oxidant in metal-catalyzed oxidation.
Tetrabutylammonium (meta)periodate (DCM) can be oxidated for the synthesis of aryl nitroso derivatives. It can also be used in the formation of an ionic liquid for the synthesis of aromatic carboxylic acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Danger |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P220-P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | O,Xi,Xn |
| Risk Statements | 8-36/37/38-20/22 |
| Safety Statements | 17-26-36-37/39 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 3 |
| F | 8 |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29239000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) or 1.0 kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





