M1528641
Hydrogenatedterphenyls , 99% , 61788-32-7
CAS NO.：61788-32-7
Empirical Formula: C18H22
Molecular Weight: 238.367
MDL number: MFCD01776909
EINECS: 262-967-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB238.40 | In Stock |
|
| 25g | RMB734.40 | In Stock |
|
| 100g | RMB2150.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 340℃ |
| Density | 1.00 g/cm3 |
| vapor pressure | 0.174Pa at 20℃ |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Oil |
| color | Pale Yellow to Light Yellow |
| Water Solubility | 61μg/L at 20℃ |
| InChI | InChI=1S/C18H22/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1,3,5,9,11-16H,2,4,6-8,10H2 |
| InChIKey | TVBYFUMVFJKKNJ-UHFFFAOYSA-N |
| SMILES | C1(C2CCCC=C2)=CC=C(C2CCC=CC2)C=C1 |
| LogP | 6.5 at 20℃ |
| EPA Substance Registry System | Hydrogenated terphenyl (61788-32-7) |
Description and Uses
Hydrogenated terphenyls are a complex mix-ture of partially hydrogenated terphenyl isomers. They areclear, oily, pale-yellow liquids with a faint odor. Molecularweight = 241.00; 298.00 (40% hydrogenated); Specificgravity (H2O:1l) = 1.00; Boiling point = 340℃ (40% hydro-genated); FreezingMelting point= 148℃ (40% hydroge-nated); V aporpressure= 13 Paat25℃;Flashpoint= 157℃ (cc); Autoignition temperature = 374℃.Insoluble in water.
