PRODUCT Properties
| Melting point: | 182-183 °C |
| Boiling point: | 778.5±60.0 °C(Predicted) |
| Density | 1.399±0.06 g/cm3(Predicted) |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 9.85±0.40(Predicted) |
| color | White to off-white |
| InChIKey | WEKCEGQSIIQPAQ-XCZVWYJYNA-N |
| SMILES | O(C1=C(C(OC)=CC([C@H]2OC[C@]3([H])[C@@H](C4C=C(OC)C(O)=C(OC)C=4)OC[C@]23[H])=C1)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)C |&1:8,11,13,27,31,32,33,35,37,r| |
Description and Uses
Acanthoside B is a natural product found in Strychnos axillaris, Dalbergia sissoo, and other organisms with data available.
Acanthoside B is mainly used for content determination and pharmacological experimental research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
