M2034735
Diclofensine , 98% , 67165-56-4
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB490.40 | In Stock |
|
| 10mg | RMB820.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 422.6±45.0 °C(Predicted) |
| Density | 1.242 |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| pka | 7.87±0.40(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C17H17Cl2NO/c1-20-9-12-7-13(21-2)4-5-14(12)15(10-20)11-3-6-16(18)17(19)8-11/h3-8,15H,9-10H2,1-2H3 |
| InChIKey | ZJDCGVDEEHWEIG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(OC)=C2)C(C2=CC=C(Cl)C(Cl)=C2)CN1C |
Description and Uses
A stimulant; inhibits reuptake of dopamine and noradrenaline, is an effective antidepressant. Compound exhibits significant addictive properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
