PRODUCT Properties
| Melting point: | 255 °C |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly, Heated), Water (Very Slightly, Heated) |
| form | Solid |
| color | Dark Yellow to Dark Brown |
| InChI | InChI=1S/C8H9NO3.ClH/c9-4-8(12)5-1-2-6(10)7(11)3-5;/h1-3,10-11H,4,9H2;1H |
| InChIKey | ILTXTELYZNIJHL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C(O)=C1)CN.[H]Cl |
Description and Uses
Noradrenalone Hydrochloride is an intermediate of Norepinephrine (N674500), an antagonist of dibutyryl cyclic AMP in the regulation of narcosis. Norepinephrine modulates human dendritic cell activation by altering cytokine release.






