M2406835
1,2-EPOXYPROPANE-D6 , ≥98atom%D , 202468-69-7
Synonym(s):
1,2-Epoxypropane-d6
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB798.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −112 °C(lit.) |
| Boiling point: | 34 °C(lit.) |
| Density | 0.916 g/mL at 25 °C |
| refractive index | n |
| Flash point: | <−30 °F |
| storage temp. | 0-6°C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Stability: | Volatile |
| InChI | 1S/C3H6O/c1-3-2-4-3/h3H,2H2,1H3/i1D3,2D2,3D |
| InChIKey | GOOHAUXETOMSMM-LIDOUZCJSA-N |
| SMILES | [2H]C([2H])([2H])C1([2H])OC1([2H])[2H] |
| CAS Number Unlabeled | 75-56-9 |
Description and Uses
1,2-EPOXYPROPANE-D6 is a labelled Propylene Oxide, used in the synthesis of polyethylene glycol for use in plastics manufacturing.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H224-H302+H312+H332-H315-H319-H335-H340-H350 |
| Precautionary statements | P210-P233-P280-P303+P361+P353-P308+P313-P403+P233 |
| target organs | Respiratory system |
| Hazard Codes | F+,T |
| Risk Statements | 45-12-20/21/22-36/37/38-46 |
| Safety Statements | 53-45 |
| RIDADR | UN 1280 3/PG 1 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Flam. Liq. 1 Muta. 1B STOT SE 3 |
