PRODUCT Properties
| storage temp. | -20°C |
| solubility | DMSO: soluble10mg/mL |
| form | White to off-white crystalline solid. |
| Boiling point: | 827.0±65.0 °C(Predicted) |
| Density | 1.036±0.06 g/cm3(Predicted) |
| Melting point: | 229 °C |
| pka | -1.08±0.70(Predicted) |
| color | White to off-white |
| biological source | Gnomonia errabunda |
| InChIKey | MIZMDSVSLSIMSC-VYLWARHZSA-N |
| SMILES | N1([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C1=O)C(C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C)C(C)C)C |
Description and Uses
Enniatins are a family of depsipeptide ionophores produced by several Fusarium species. Recently, the effects of the enniatins on acyl-CoA cholesterol transferase, transporters and the selectivity of their antitumor action have received more focus. Enniatin B is the most studied of four major analogues of the enniatin complex.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29419000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |






