M4364353
EnniatinA1 , ≥95% , 4530-21-6
Synonym(s):
2-(N-Methyl-L-valine) Enniatin A;Cyclo[(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl]
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB5440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-117 °C |
| Boiling point: | 840.5±65.0 °C(Predicted) |
| Density | 1.027±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: soluble10mg/mL |
| form | White to off-white crystalline solid. |
| pka | -1.44±0.70(Predicted) |
| biological source | Gnomonia errabunda |
| InChIKey | OWUREPXBPJFMOK-UHFFFAOYSA-N |
| SMILES | O1C(C(C)C)C(N(C)C(C(C)CC)C(OC(C(C)C)C(N(C)C(C(C)CC)C(OC(C(C)C)C(N(C)C(C(C)C)C1=O)=O)=O)=O)=O)=O |
Description and Uses
Enniatin A1 is a mycotoxin capable of creating negative CNS effects due to their ability to cross the blod-brain barrier. Secondary metabolite of microbes, it is associated with mold, moisture damage and asthma development.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(a) |
| PackingGroup | I |







