M2421835
Estradiol-3-benzoate-17-butyrate , 98% , 63042-18-2
CAS NO.:63042-18-2
Empirical Formula: C29H34O4
Molecular Weight: 446.58
MDL number: MFCD00056540
EINECS: 263-807-9
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB31.20 | In Stock |
|
| 25mg | RMB84.80 | In Stock |
|
| 100mg | RMB228.80 | In Stock |
|
| 500mg | RMB718.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128.5-129.0 °C |
| Boiling point: | 558.6±50.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| InChIKey | MKYFGNOOEKZNPW-PFQOISFUNA-N |
| SMILES | [C@@]12([H])CC[C@H](OC(=O)CCC)[C@@]1(C)CC[C@]1([H])C3C=CC(OC(=O)C4C=CC=CC=4)=CC=3CC[C@@]21[H] |&1:0,4,11,15,34,r| |
Description and Uses
Estradiol-3-benzoate-17-butyrate is a long-lasting and potent estrogen ester that can cause significant physiological and pathological changes in the sex organs and may induce progesterone-like changes in the vagina in the later stages of its action. It also has a wide range of effects on multiple organ systems throughout the body.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H312-H351-H332-H302 |
| Precautionary statements | P261-P271-P304+P340-P312-P280-P302+P352-P312-P322-P363-P501-P201-P202-P281-P308+P313-P405-P501-P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |





