PRODUCT Properties
| Melting point: | 240 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1D2 |
| InChIKey | DHMQDGOQFOQNFH-DICFDUPASA-N |
| SMILES | C(=O)(O)C([2H])([2H])N |
| CAS Number Unlabeled | 56-40-6 |
| CAS Number Unlabeled | 56-40-6 |
| CAS Number Unlabeled | 4896-75-7 |
Description and Uses
Glycine-d2, is the labeled analogue of Glycine (G615990), a non-essential amino acid for human development. Glycine is an inhibitory neurotransmitter in spinal cord, allosteric regulator of NMDA receptors.
