M2795735
GanodericacidDM , 97% , 173075-45-1
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2604.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | Methanol: soluble |
| form | Powder |
| color | White to off-white |
| InChIKey | ZTKZZRIVAYGFSF-PIPDTRPPSA-N |
| SMILES | C1(=O)[C@@]([C@]2([C@](C)(CC1)C1=C([C@]3([C@@](CC1)(C)[C@@H]([C@H](C)CC/C=C(\C)/C(O)=O)CC3)C)C(=O)C2)[H])(C)C |
Description and Uses
Ganoderic acid DM, a natural triterpenoid isolated from Ganoderma lucidum, induces DNA damage, G1 cell cycle arrest and apoptosis in human breast cancer cells. Ganoderic acid DM as a specific inhibitor of osteoclastogenesis[1][2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P362+P364-P332+P313-P337+P313-P403+P233-P405-P501 |






