28-Homobrassinolide , ≥90%(HPLC) , 74174-44-0
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB329.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 643.0±55.0 °C(Predicted) |
| Density | 1.130±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | DMF: 1 mg/mL; DMSO: 5 mg/mL; Ethanol: Slightly soluble |
| form | A solid |
| pka | 14.27±0.70(Predicted) |
| color | White to off-white |
| InChIKey | YIWIWAWDXLBOKO-YHFMMDKCNA-N |
| SMILES | O1[C@H](C(C)C(O)C(O)[C@@H](CC)C(C)C)C2[C@]3(C)C(CCC3)[C@@H](O)[C@@H](O)C2C2CC(=O)CC[C@]2([H])[C@@H]1C |&1:1,8,15,21,23,32,34,r| |
Description and Uses
28-Homobrassinolide being an analogue of brassinosteroids is improve the growth, yield and quality parameters in many crop plants. 28-Homobrassinolide 0.1% is recommended as foliar spray for most agricultural and horticultural crops such as :Grain crops such as Rice, and WheatVegetable crops such as Eggplant, Tomato, Bell pepper and Other Varieties such as Okra, Cabbage, and CauliflowerFiber crops such as CottonTuber crops such as PotatoOil seeds such as Peanut, Sunflower, and SoybeanPerennial flowering plants such as Jasmine, and RoseAnnual flowering plants such as MarigoldCash crops such as Banana, Sugarcane, Sugar beets, Tea, Coffee, and PepperFruit crops such as Grapes (Table and Wine), PomegranateNut crops such as Almonds and Walnuts 28-Homobrassinolide 0.1% is fully biodegradable, leaves no residues, and is environment friendly.





