M3292835
ICG-001 , ≥98% , 780757-88-2
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB646.40 | In Stock |
|
| 25mg | RMB1928.00 | In Stock |
|
| 100mg | RMB5784.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-134℃ |
| Boiling point: | 895.6±65.0 °C(Predicted) |
| Density | 1.37 |
| storage temp. | Store at -20°C |
| solubility | DMSO:30.0(Max Conc. mg/mL);54.68(Max Conc. mM) |
| form | A crystalline solid |
| pka | 9.88±0.15(Predicted) |
| color | White to off-white |
| InChIKey | HQWTUOLCGKIECB-XZWHSSHBSA-N |
| SMILES | [C@]12([H])CN(CC3=C4C(C=CC=C4)=CC=C3)C(=O)[C@H](CC3=CC=C(O)C=C3)N1C(=O)CCN2C(NCC1=CC=CC=C1)=O |
Description and Uses
ICG 001 is a small molecule inhibitor of Wnt/β-catenin signaling.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P330-P302+P352-P321-P304+P340-P305+P351+P338-P332+P313-P362+P364-P337+P313-P403+P233-P405-P501 |
