M3302235
Imazethapyr , 98% , 81335-77-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB52.80 | In Stock |
|
| 25g | RMB214.40 | In Stock |
|
| 100g | RMB688.00 | In Stock |
|
| 500g | RMB2752.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-173°C |
| Boiling point: | 431.49°C (rough estimate) |
| Density | 1.1302 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: 83.33 mg/mL (288.01 mM) |
| form | Solid |
| pka | pK1 2.1; pK2 3.9(at 25℃) |
| color | White to light yellow |
| BRN | 7437150 |
| Major Application | agriculture environmental |
| InChI | 1S/C15H19N3O3/c1-5-9-6-10(13(19)20)11(16-7-9)12-17-14(21)15(4,18-12)8(2)3/h6-8H,5H2,1-4H3,(H,19,20)(H,17,18,21) |
| InChIKey | XVOKUMIPKHGGTN-UHFFFAOYSA-N |
| SMILES | CCc1cnc(C2=NC(C)(C(C)C)C(=O)N2)c(c1)C(O)=O |
| CAS DataBase Reference | 81335-77-5(CAS DataBase Reference) |
| EPA Substance Registry System | Imazethapyr (81335-77-5) |
Description and Uses
Imazethapyr is a herbicide that that is used in biological studies to evaluate the effect on non-target vegetation within agroecosystems.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410-H400 |
| Precautionary statements | P273-P391-P501-P273-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 1 |
| RTECS | US5682900 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 81335-77-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats and mice: >5000 mg/kg; dermally in rabbits: >2000 mg/kg (Peoples) |





