M3313535
Iodipamide , ≥99% , 606-17-7
Synonym(s):
3,3′(Adipoyldiimino)bis(2,4,6-triiodobenzoic acid);Adipiodone;Iodipamide
CAS NO.：606-17-7
Empirical Formula: C20H14I6N2O6
Molecular Weight: 1139.76
MDL number: MFCD00058983
EINECS: 210-105-5
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB547.20 | In Stock |
|
| 10mg | RMB820.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 306-308°C (dec.) |
| Boiling point: | 908.6±65.0 °C(Predicted) |
| Density | 2.5848 (estimate) |
| refractive index | nD21.5 1.3294 (c = 0.445 in methanol) |
| storage temp. | Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| pka | pKa 3.5(H2O) (Uncertain) |
| form | Solid |
| color | White |
| Water Solubility | 0.46g/L(20 ºC) |
| Merck | 5022 |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | FFINMCNLQNTKLU-UHFFFAOYSA-N |
| SMILES | OC(=O)c1c(I)cc(I)c(NC(=O)CCCCC(=O)Nc2c(I)cc(I)c(C(O)=O)c2I)c1I |
| EPA Substance Registry System | Benzoic acid, 3,3'-[(1,6-dioxo-1,6-hexanediyl)diimino]bis[2,4,6-triiodo- (606-17-7) |
Description and Uses
antihypertensive, diuretic, activates K channels and AMPA receptors
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| WGK Germany | 3 |
| RTECS | DG0949500 |
| HS Code | 2924296000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 606-17-7(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): 2380 ±290, 4430 ±310 i.v. (Rosenberg) |
