M3342251
1-(2-(2,4-Dichlorophenyl)pentyl)-1H-1,2,4-triazole , 98% , 66246-88-6
CAS NO.：66246-88-6
Empirical Formula: C13H15Cl2N3
Molecular Weight: 284.18
MDL number: MFCD00078737
EINECS: 266-275-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB384.00 | In Stock |
|
| 1g | RMB768.00 | In Stock |
|
| 5g | RMB2144.00 | In Stock |
|
| 25g | RMB4224.00 | In Stock |
|
| 100g | RMB7984.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58.5 °C |
| Boiling point: | 436.06°C (rough estimate) |
| Density | 1.2556 (rough estimate) |
| vapor pressure | 3.7 x l0-4 Pa (25 °C) |
| refractive index | 1.6300 (estimate) |
| Flash point: | 100 °C |
| storage temp. | 0-6°C |
| solubility | DMSO: 100 mg/mL (351.89 mM) |
| pka | 2.80±0.10(Predicted) |
| form | Solid |
| Water Solubility | 73 mg l-1 (25 °C) |
| color | White |
| BRN | 541488 |
| Major Application | agriculture environmental |
| InChI | 1S/C13H15Cl2N3/c1-2-3-10(7-18-9-16-8-17-18)12-5-4-11(14)6-13(12)15/h4-6,8-10H,2-3,7H2,1H3 |
| InChIKey | WKBPZYKAUNRMKP-UHFFFAOYSA-N |
| SMILES | CCCC(Cn1cncn1)c2ccc(Cl)cc2Cl |
| LogP | 3.660 (est) |
| CAS DataBase Reference | 66246-88-6(CAS DataBase Reference) |
| EPA Substance Registry System | Penconazole (66246-88-6) |
Description and Uses
Penconazole is used for the control of powdery mildew, pome fruit scab and other pathogenic Ascomycetes, Basidiomycetes and Deuteromycetes on vines, cucurbits, pome fruit, stone fruit, ornamentals, hops, tobacco and vegetables.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H361d-H410 |
| Precautionary statements | P201-P264-P273-P280-P308+P313-P391 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | XZ4615000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Toxicity | LD50 skn-rat: >3 g/kg DOVEAA 38,195,84 |
