PRODUCT Properties
| Melting point: | >240°C (dec.) |
| Density | 1.848±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Water (Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 8?+-.0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C9H12N2O7/c12-2-4-5(14)6(15)8(18-4)11-1-3(13)7(16)10-9(11)17/h1,4-6,8,12-15H,2H2,(H,10,16,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | QXDXBKZJFLRLCM-UAKXSSHOSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=C(O)C(=O)NC2=O)[C@H](O)[C@@H]1O |
Description and Uses
5-Hydroxyuridine is a uridine (U829910), a nucleoside; widely distributed in nature. Uridine is one of the four basic components of ribonucleic acid (RNA).






