M3450657
Methotrexate-d3 , ≥98% , 432545-63-6
CAS NO.：432545-63-6
Empirical Formula: C20H19D3N8O5
Molecular Weight: 457.46
MDL number: MFCD08063571
EINECS: 803-954-3
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB4800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210°C dec. |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Orange to Dark Yellow |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | FBOZXECLQNJBKD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(Cc1cnc2nc(N)nc(N)c2n1)c3ccc(cc3)C(=O)NC(CCC(O)=O)C(O)=O |
Description and Uses
METHOTREXATE-D3 is a Folic acid antagonistand ,used as a antineoplastic and antirheumatic.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310+P330-P308+P311-P403+P233 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 Met. Corr. 1 STOT SE 1 |
