M3593357
3''-Sialyllactose , ＞95% , 35890-38-1
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB5760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 1132.8±65.0 °C(Predicted) |
| Density | 1.72±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | water: 20 mg/mL, clear, colorless |
| pka | 1.92±0.70(Predicted) |
| form | powder |
| color | white |
| biological source | bovine milk or colostrum |
| Water Solubility | water: 20mg/mL, clear, colorless |
| BRN | 75357 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | LTWFUJWFLMHANB-TZCPRLTCSA-M |
| SMILES | [Na+].[H]C(=O)[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[C@@]2(C[C@H](O)[C@@H](NC(C)=O)[C@@H](O2)[C@H](O)[C@H](O)CO)C([O-])=O)[C@H]1O)[C@H](O)CO |
| EPA Substance Registry System | D-Glucose, O-(N-acetyl-.alpha.-neuraminosyl)-(2.fwdarw.3)-O-.beta.-D-galactopyranosyl-(1.fwdarw.4)- (35890-38-1) |
Description and Uses
3′-Sialyllactose is a compound where in the acetylneuraminyl (NANA) unit is connected to the galactosyl unit of lactose at the 3 position. In 6′-sialylactose, this connection is at the 6 position. 3′-Sialyllactose and 6′-Sialyllactose are used to differentiate and characterize binding domains of viruses, such as influenza and rhinitis viruses, that recognize NANA capped cell surface receptors. 3′-Sialyllactose and 6′-sialylactose are used as reference compounds in analytical methods developed to measure their presence in materials such as milk and colostrums.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | B |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
