M3599057
1,3,6-Tri-O-galloyl-beta-D-glucose , ≥98% , 18483-17-5
Synonym(s):
Tannic acid (Corilagin);β-D -Glucopyranose 1,3,6-trigallate;β-D -Glucopyranose-1,3,6-tris(3,4,5-trihydroxybenzoate);1,3,6-Tri-O-galloyl-β-D -glucopyranose;1,3,6-Tri-O-galloyl-β-D-glucopyranose
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB3005.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167℃ |
| Boiling point: | 1103.6±65.0 °C(Predicted) |
| Density | 1.98 |
| storage temp. | -20°C |
| form | Solid |
| pka | 8.37±0.15(Predicted) |
| color | White to off-white |
| BRN | 76215 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | RNKMOGIPOMVCHO-SJMVAQJGSA-N |
| SMILES | O=C(C1=CC(O)=C(O)C(O)=C1)O[C@H]2[C@H](O)[C@@H](OC(C3=CC(O)=C(O)C(O)=C3)=O)[C@H](O)[C@@H](COC(C4=CC(O)=C(O)C(O)=C4)=O)O2 |
Description and Uses
1,3,6-Trigalloylglucose is a tannin obtained from Picrorhiza kurroa seeds which exhibit lipid peroxidation and cyclooxygenase inhibitory activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





