M3691557
PseudolaricAcid??A-O-beta-D-glucopyranoside , ≥98% , 98891-44-2
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB720.00 | In Stock |
|
| 20mg | RMB1600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.37±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| form | Solid |
| color | White to off-white |
| InChIKey | IVYWRYGMQNKDQB-VHJBJYHKSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC(=O)\C(=C\C=C\[C@]2(OC(=O)[C@]43[C@@]([C@H]2CC4)(CCC(=CC3)C)OC(=O)C)C)\C |
Description and Uses
Pseudolaric acid A O-β-D-Glucopyranoside is a major diterpenoid in Pseudolarix kaempferi. A potential antitumor agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Repr. 2 |






