M3720857
Pseudohypericin , ≥98% , 55954-61-5
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3824.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 1089.1±65.0 °C(Predicted) |
| Density | 1.994±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 7.16±0.20(Predicted) |
| color | brown |
| InChIKey | YXBUQQDFTYOHQI-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c2C(=O)c3c(O)cc(O)c4c5c(O)cc(O)c6C(=O)c7c(O)cc(CO)c8c1c2c(c34)c(c56)c78 |
| CAS DataBase Reference | 55954-61-5(CAS DataBase Reference) |
Description and Uses
Pseudohypericin is a specific inhibitor of protein kinase C and D-β-Hydroxylase. Also, it is used in determination of potential drug candidate molecules of Hypericum perforatum for COVID-19 treatment.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 55954-61-5(Hazardous Substances Data) |
