M3764157
PD180970 , ≥98% , 287204-45-9
Synonym(s):
6-(2,6-Dichlorophenyl)-2-[(4-fluoro-3-methylphenyl)amino]-8-methyl-pyrido[2,3-d]pyrimidin-7(8H)-one;PF-1515965
CAS NO.：287204-45-9
Empirical Formula: C21H15Cl2FN4O
Molecular Weight: 429.27
MDL number: MFCD10565929
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 590.6±60.0 °C(Predicted) |
| Density | 1.449±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: >20mg/mL |
| pka | 3.02±0.20(Predicted) |
| form | A solid |
| color | yellow |
| InChI | 1S/C21H15Cl2FN4O/c1-11-8-13(6-7-17(11)24)26-21-25-10-12-9-14(20(29)28(2)19(12)27-21)18-15(22)4-3-5-16(18)23/h3-10H,1-2H3,(H,25,26,27) |
| InChIKey | SLCFEJAMCRLYRG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=Cc2cnc(Nc3ccc(F)c(C)c3)nc12)c4c(Cl)cccc4Cl |
Description and Uses
PD 180970 is an ATP-competitive inhibitor of p210 tyrosine kinase which selectively induces apoptosis in chronic myeloid leukemia (CML) K562 cells.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H413 |
| Precautionary statements | P273-P301+P310+P330 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 |
