M3794957
MonacolinJ , ≥95% , 79952-42-4
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-53°C |
| Boiling point: | 535.7±50.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), DMF, DMSO, Methanol (Slightly) |
| form | Solid |
| pka | 13.49±0.40(Predicted) |
| color | White to Pale Yellow |
| Stability: | Hygroscopic |
| InChIKey | ZDFOBOYQVYMVCW-IRUSZSJRSA-N |
| SMILES | C1(=O)O[C@H](CC[C@@H]2[C@]3([H])C(=C[C@H](C)C[C@@H]3O)C=C[C@@H]2C)C[C@@H](O)C1 |
Description and Uses
Monacolin J is a Simvastatin intermediate; Lovastatin analog has the activities of decreasing blood cholesterol and low-d. lipoprotein, can be used to preparation hypolipidemic medicine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
