M3888735
Methyltinmercaptide , Sn>18.8% , 57583-35-4
CAS NO.:57583-35-4
Empirical Formula: C22H44O4S2Sn
Molecular Weight: 555.42
MDL number:
EINECS: 260-829-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB31.20 | In Stock |
|
| 100g | RMB84.80 | In Stock |
|
| 500g | RMB318.40 | In Stock |
|
| 2.5kg | RMB1212.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 515.6±60.0 °C(Predicted) |
| Density | 1.18[at 20℃] |
| vapor pressure | 0.81Pa at 25℃ |
| solubility | 250g/L in organic solvents at 20 ℃ |
| Water Solubility | 4.51mg/L at 20℃ |
| InChI | InChI=1S/2C10H20O2S.2CH3.Sn/c2*1-3-5-6-9(4-2)7-12-10(11)8-13;;;/h2*9,13H,3-8H2,1-2H3;2*1H3;/q;;;;+2/p-2 |
| InChIKey | YAHBZWSDRFSFOO-UHFFFAOYSA-L |
| SMILES | C(OCC(CC)CCCC)(=O)CS[Sn](C)(C)SCC(=O)OCC(CC)CCCC |
| LogP | 4.74-8.5 at 20℃ |
| CAS DataBase Reference | 57583-35-4(CAS DataBase Reference) |
| EPA Substance Registry System | 8-Oxa-3,5-dithia-4-stannatetradecanoic acid, 10-ethyl-4,4-dimethyl-7-oxo-, 2-ethylhexyl ester (57583-35-4) |
Description and Uses
Methyltin Mercaptide is a??potential therapeutic agent used against microbial diseases such as severe acute respiratory syndrome and dengue in human and animal model
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H317-H361d-H372 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P260-P264-P270-P314-P501 |
| TSCA | TSCA listed |







