M3933735
γ-Mangostin , ≥98%(HPLC) , 31271-07-5
Synonym(s):
1,3,6,7-Tetrahydroxy-2,8-bis(3,3-dimethylallyl)xanthone;Demethylmangostin;Normangostin
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB1541.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206-208 °C |
| Boiling point: | 648.4±55.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble1mg/mL, colorless to yellow |
| form | powder |
| pka | 7.05±0.20(Predicted) |
| color | off-white to yellow |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | InChI=1S/C23H24O6/c1-11(2)5-7-13-15(24)9-18-20(22(13)27)23(28)19-14(8-6-12(3)4)21(26)16(25)10-17(19)29-18/h5-6,9-10,24-27H,7-8H2,1-4H3 |
| InChIKey | VEZXFTKZUMARDU-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(O)C(O)=C2C/C=C(/C)\C)OC2=C1C(O)=C(C/C=C(/C)\C)C(O)=C2 |
| LogP | 5.744 (est) |
Description and Uses
Gamma-Mangostin is a xanthones which displays anti-oxidant properties and could be a promising compound for the therapy of AlzheimerтАЩs disease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | ZD6122330 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






