PRODUCT Properties
| Melting point: | 225° |
| Boiling point: | 597.9±60.0 °C(Predicted) |
| Density | 1.6122 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.4(at 25℃) |
| color | White to Off-White |
| Water Solubility | 50mg/L(room temperature) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C9H11Cl2N3O4S2/c1-14-9(4-10)13-6-2-5(11)7(19(12,15)16)3-8(6)20(14,17)18/h2-3,9,13H,4H2,1H3,(H2,12,15,16) |
| InChIKey | CESYKOGBSMNBPD-UHFFFAOYSA-N |
| SMILES | [S]1(=O)(=O)N(C(Nc2c1cc(c(c2)Cl)[S](=O)(=O)N)CCl)C |
| EPA Substance Registry System | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3-(chloromethyl)-3,4-dihydro-2-methyl-, 1,1-dioxide (135-07-9) |
Description and Uses
Methyclothiazid, is derivative of Hydrochlorothiazide (H714560), which is a diuretic used in the hospital or for personal use to promote excess fluid associated with congestive heart failure. It is also used as an antihypertensive.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P330-P302+P352-P321-P304+P340-P305+P351+P338-P332+P313-P362+P364-P337+P313-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2935904000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 135-07-9(Hazardous Substances Data) |
