M4025935
Moranteltartrate , BR , 26155-31-7
Synonym(s):
1,4,5,6-Tetrahydro-1-methyl-2-(2-[3-methyl-2-thienyl]ethenyl)pyrimidine;Morantel (+)-tartrate salt
CAS NO.：26155-31-7
Empirical Formula: C16H22N2O6S
Molecular Weight: 370.42
MDL number: MFCD00079449
EINECS: 247-481-5
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1317.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164 - 168°C |
| storage temp. | Refrigerator |
| solubility | H2O: soluble4.0ML, very slightly hazy, light yellow (200 mg + 4.0 mL H2O) |
| form | Solid |
| color | light yellow |
| BRN | 8739506 |
| Major Application | clinical testing |
| InChIKey | XMDWLUCAURURDF-CIIIEQSVSA-N |
| SMILES | O.O[C@H]([C@@H](O)C(O)=O)C(O)=O.CN1CCCN=C1\C=C\c2sccc2C |
| CAS DataBase Reference | 26155-31-7(CAS DataBase Reference) |
Description and Uses
Morantel Tartrate is a tetrahydropyrimidine compound and the 3-methyl thiophene tartrate salt analog of pyrantel tartrate, a swine and equine anthelmintic effective against the immature and adult stages of certain nematodes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332 |
| Precautionary statements | P261-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | UW0246000 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
